C19H23NO10S — CID 46929603
[(2R,3R,4R,5R,6S)-3,4,6-triacetyloxy-5-(thiophene-3-carbonylamino)oxan-2-yl]methyl acetate (PubChem CID 46929603) has the molecular formula C19H23NO10S and a molecular weight of 457.46 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6S)-3,4,6-triacetyloxy-5-(thiophene-3-carbonylamino)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R,6S)-3,4,6-triacetyloxy-5-(thiophene-3-carbonylamino)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 46929603 |
| Molecular Formula | C19H23NO10S |
| Molecular Weight | 457.46 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | [(2R,3R,4R,5R,6S)-3,4,6-triacetyloxy-5-(thiophene-3-carbonylamino)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OC(C)=O)[C@H](NC(=O)c2ccsc2)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C19H23NO10S/c1-9(21)26-7-14-16(27-10(2)22)17(28-11(3)23)15(19(30-14)29-12(4)24)20-18(25)13-5-6-31-8-13/h5-6,8,14-17,19H,7H2,1-4H3,(H,20,25)/t14-,15-,16+,17-,19-/m1/s1 |
| InChIKey | HDUKGCUCTOQGPS-OGJJZOIMSA-N |
| XLogP | 0.56 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.46 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|