C20H25NO10S — CID 46929604
[(2R,3R,4R,5R,6S)-3,4,6-triacetyloxy-5-[(3-methylthiophene-2-carbonyl)amino]oxan-2-yl]methyl acetate (PubChem CID 46929604) has the molecular formula C20H25NO10S and a molecular weight of 471.48 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6S)-3,4,6-triacetyloxy-5-[(3-methylthiophene-2-carbonyl)amino]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R,6S)-3,4,6-triacetyloxy-5-[(3-methylthiophene-2-carbonyl)amino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 46929604 |
| Molecular Formula | C20H25NO10S |
| Molecular Weight | 471.48 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | [(2R,3R,4R,5R,6S)-3,4,6-triacetyloxy-5-[(3-methylthiophene-2-carbonyl)amino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OC(C)=O)[C@H](NC(=O)c2sccc2C)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C20H25NO10S/c1-9-6-7-32-18(9)19(26)21-15-17(29-12(4)24)16(28-11(3)23)14(8-27-10(2)22)31-20(15)30-13(5)25/h6-7,14-17,20H,8H2,1-5H3,(H,21,26)/t14-,15-,16+,17-,20-/m1/s1 |
| InChIKey | DDAVVJZGJQFKQQ-ISIBIEBGSA-N |
| XLogP | 0.87 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.48 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|