C18H25NO10 — CID 100860274
[(2R,3S,4R,5S,6S)-3,4,6-triacetyloxy-5-(2-methylprop-2-enoylamino)oxan-2-yl]methyl acetate (PubChem CID 100860274) has the molecular formula C18H25NO10 and a molecular weight of 415.40 g/mol. Its IUPAC name is [(2R,3S,4R,5S,6S)-3,4,6-triacetyloxy-5-(2-methylprop-2-enoylamino)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5S,6S)-3,4,6-triacetyloxy-5-(2-methylprop-2-enoylamino)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 100860274 |
| Molecular Formula | C18H25NO10 |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | [(2R,3S,4R,5S,6S)-3,4,6-triacetyloxy-5-(2-methylprop-2-enoylamino)oxan-2-yl]methyl acetate |
| SMILES | C=C(C)C(=O)N[C@@H]1[C@H](OC(C)=O)O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C18H25NO10/c1-8(2)17(24)19-14-16(27-11(5)22)15(26-10(4)21)13(7-25-9(3)20)29-18(14)28-12(6)23/h13-16,18H,1,7H2,2-6H3,(H,19,24)/t13-,14+,15-,16-,18-/m1/s1 |
| InChIKey | SPMOJIMKIOIXRO-ORDFZIBCSA-N |
| XLogP | -0.24 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|