C16H23NO9S — CID 11825649
[(2R,3S,4R,5R,6R)-3,4,6-triacetyloxy-5-(ethanethioylamino)oxan-2-yl]methyl acetate (PubChem CID 11825649) has the molecular formula C16H23NO9S and a molecular weight of 405.43 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-3,4,6-triacetyloxy-5-(ethanethioylamino)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-3,4,6-triacetyloxy-5-(ethanethioylamino)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11825649 |
| Molecular Formula | C16H23NO9S |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-3,4,6-triacetyloxy-5-(ethanethioylamino)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](OC(C)=O)[C@H](NC(C)=S)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C16H23NO9S/c1-7(27)17-13-15(24-10(4)20)14(23-9(3)19)12(6-22-8(2)18)26-16(13)25-11(5)21/h12-16H,6H2,1-5H3,(H,17,27)/t12-,13-,14-,15-,16+/m1/s1 |
| InChIKey | MUIBCFKGNYZSBG-QCODTGAPSA-N |
| XLogP | 0.01 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|