C18H28N2O9S — CID 86638176
[(2R,3S,4R,5R,6S)-3,4,6-triacetyloxy-5-[[ethyl(methyl)carbamothioyl]amino]oxan-2-yl]methyl acetate (PubChem CID 86638176) has the molecular formula C18H28N2O9S and a molecular weight of 448.49 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-3,4,6-triacetyloxy-5-[[ethyl(methyl)carbamothioyl]amino]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6S)-3,4,6-triacetyloxy-5-[[ethyl(methyl)carbamothioyl]amino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 86638176 |
| Molecular Formula | C18H28N2O9S |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-3,4,6-triacetyloxy-5-[[ethyl(methyl)carbamothioyl]amino]oxan-2-yl]methyl acetate |
| SMILES | CCN(C)C(=S)N[C@H]1[C@H](OC(C)=O)O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C18H28N2O9S/c1-7-20(6)18(30)19-14-16(27-11(4)23)15(26-10(3)22)13(8-25-9(2)21)29-17(14)28-12(5)24/h13-17H,7-8H2,1-6H3,(H,19,30)/t13-,14-,15-,16-,17-/m1/s1 |
| InChIKey | NEYDRFBLFLBNBM-WRQOLXDDSA-N |
| XLogP | -0.10 |
| TPSA | 129.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|