C16H23NO11 — CID 10501446
[(2R,3S,4R,5S)-3,4,6-triacetyloxy-5-(methoxycarbonylamino)oxan-2-yl]methyl acetate (PubChem CID 10501446) has the molecular formula C16H23NO11 and a molecular weight of 405.36 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-3,4,6-triacetyloxy-5-(methoxycarbonylamino)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5S)-3,4,6-triacetyloxy-5-(methoxycarbonylamino)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10501446 |
| Molecular Formula | C16H23NO11 |
| Molecular Weight | 405.36 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | [(2R,3S,4R,5S)-3,4,6-triacetyloxy-5-(methoxycarbonylamino)oxan-2-yl]methyl acetate |
| SMILES | COC(=O)N[C@@H]1C(OC(C)=O)O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C16H23NO11/c1-7(18)24-6-11-13(25-8(2)19)14(26-9(3)20)12(17-16(22)23-5)15(28-11)27-10(4)21/h11-15H,6H2,1-5H3,(H,17,22)/t11-,12+,13-,14-,15?/m1/s1 |
| InChIKey | HYTWCUWJEDXJMI-PFNKYVCDSA-N |
| XLogP | -0.57 |
| TPSA | 152.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.36 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|