C16H21Cl3N2O10 — CID 134878670
[(2R,3S,4R,5R,6R)-3,4-diacetyloxy-5-(methoxycarbonylamino)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate (PubChem CID 134878670) has the molecular formula C16H21Cl3N2O10 and a molecular weight of 507.71 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-5-(methoxycarbonylamino)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-5-(methoxycarbonylamino)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 134878670 |
| Molecular Formula | C16H21Cl3N2O10 |
| Molecular Weight | 507.71 g/mol |
| Exact Mass | 506.03 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-5-(methoxycarbonylamino)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate |
| SMILES | [H]/N=C(/O[C@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1NC(=O)OC)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H21Cl3N2O10/c1-6(22)27-5-9-11(28-7(2)23)12(29-8(3)24)10(21-15(25)26-4)13(30-9)31-14(20)16(17,18)19/h9-13,20H,5H2,1-4H3,(H,21,25)/b20-14+/t9-,10-,11-,12-,13-/m1/s1 |
| InChIKey | GWCMCXZTYPQIJI-DZSCAXHWSA-N |
| XLogP | 1.23 |
| TPSA | 159.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.71 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|