C15H17Cl6FN2O8 — CID 102418228
[(2R,3S,4R,5R,6S)-4-acetyloxy-3-fluoro-6-(2,2,2-trichloroethanimidoyl)oxy-5-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]methyl acetate (PubChem CID 102418228) has the molecular formula C15H17Cl6FN2O8 and a molecular weight of 585.02 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-4-acetyloxy-3-fluoro-6-(2,2,2-trichloroethanimidoyl)oxy-5-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6S)-4-acetyloxy-3-fluoro-6-(2,2,2-trichloroethanimidoyl)oxy-5-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102418228 |
| Molecular Formula | C15H17Cl6FN2O8 |
| Molecular Weight | 585.02 g/mol |
| Exact Mass | 581.91 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-4-acetyloxy-3-fluoro-6-(2,2,2-trichloroethanimidoyl)oxy-5-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]methyl acetate |
| SMILES | [H]/N=C(/O[C@@H]1O[C@H](COC(C)=O)[C@@H](F)[C@H](OC(C)=O)[C@H]1NC(=O)OCC(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C15H17Cl6FN2O8/c1-5(25)28-3-7-8(22)10(30-6(2)26)9(24-13(27)29-4-14(16,17)18)11(31-7)32-12(23)15(19,20)21/h7-11,23H,3-4H2,1-2H3,(H,24,27)/b23-12+/t7-,8-,9-,10+,11+/m1/s1 |
| InChIKey | YBPOSWAYQVALGW-UBIARELXSA-N |
| XLogP | 3.37 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.02 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|