C32H26Cl6N2O10 — CID 10605408
[(2R,3S,4R,5R,6R)-3,4-dibenzoyloxy-6-(2,2,2-trichloroethanimidoyl)oxy-5-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]methyl benzoate (PubChem CID 10605408) has the molecular formula C32H26Cl6N2O10 and a molecular weight of 811.28 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-3,4-dibenzoyloxy-6-(2,2,2-trichloroethanimidoyl)oxy-5-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,4R,5R,6R)-3,4-dibenzoyloxy-6-(2,2,2-trichloroethanimidoyl)oxy-5-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 10605408 |
| Molecular Formula | C32H26Cl6N2O10 |
| Molecular Weight | 811.28 g/mol |
| Exact Mass | 807.97 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-3,4-dibenzoyloxy-6-(2,2,2-trichloroethanimidoyl)oxy-5-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]methyl benzoate |
| SMILES | [H]/N=C(/O[C@H]1O[C@H](COC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@H]1NC(=O)OCC(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C32H26Cl6N2O10/c33-31(34,35)17-46-30(44)40-22-24(49-27(43)20-14-8-3-9-15-20)23(48-26(42)19-12-6-2-7-13-19)21(47-28(22)50-29(39)32(36,37)38)16-45-25(41)18-10-4-1-5-11-18/h1-15,21-24,28,39H,16-17H2,(H,40,44)/b39-29+/t21-,22-,23-,24-,28-/m1/s1 |
| InChIKey | XKAXYSWPGXEABY-VGOYELIBSA-N |
| XLogP | 6.85 |
| TPSA | 159.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.28 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|