C41H33NO10 — CID 21039570
[(2R,3S,4R,5R,6S)-5-benzamido-3,4,6-tribenzoyloxyoxan-2-yl]methyl benzoate (PubChem CID 21039570) has the molecular formula C41H33NO10 and a molecular weight of 699.71 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-5-benzamido-3,4,6-tribenzoyloxyoxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,4R,5R,6S)-5-benzamido-3,4,6-tribenzoyloxyoxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 21039570 |
| Molecular Formula | C41H33NO10 |
| Molecular Weight | 699.71 g/mol |
| Exact Mass | 699.21 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-5-benzamido-3,4,6-tribenzoyloxyoxan-2-yl]methyl benzoate |
| SMILES | O=C(N[C@H]1[C@H](OC(=O)c2ccccc2)O[C@H](COC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C41H33NO10/c43-36(27-16-6-1-7-17-27)42-33-35(51-39(46)30-22-12-4-13-23-30)34(50-38(45)29-20-10-3-11-21-29)32(26-48-37(44)28-18-8-2-9-19-28)49-41(33)52-40(47)31-24-14-5-15-25-31/h1-25,32-35,41H,26H2,(H,42,43)/t32-,33-,34-,35-,41+/m1/s1 |
| InChIKey | IBOZRGUIKQVRQF-QFYNTDBUSA-N |
| XLogP | 5.68 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.71 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|