C33H34Cl6N2O8 — CID 11181932
[(3R,4R,5S,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethoxymethyl)-3-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl] 2,2,2-trichloroethanimidate (PubChem CID 11181932) has the molecular formula C33H34Cl6N2O8 and a molecular weight of 799.36 g/mol. Its IUPAC name is [(3R,4R,5S,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethoxymethyl)-3-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl] 2,2,2-trichloroethanimidate.
| Compound Name | [(3R,4R,5S,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethoxymethyl)-3-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 11181932 |
| Molecular Formula | C33H34Cl6N2O8 |
| Molecular Weight | 799.36 g/mol |
| Exact Mass | 796.04 |
| IUPAC Name | [(3R,4R,5S,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethoxymethyl)-3-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/OC1O[C@H](COCOCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1NC(=O)OCC(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C33H34Cl6N2O8/c34-32(35,36)20-47-31(42)41-26-28(46-18-24-14-8-3-9-15-24)27(45-17-23-12-6-2-7-13-23)25(48-29(26)49-30(40)33(37,38)39)19-44-21-43-16-22-10-4-1-5-11-22/h1-15,25-29,40H,16-21H2,(H,41,42)/b40-30+/t25-,26-,27-,28-,29?/m1/s1 |
| InChIKey | LFMCABSOKHXLGT-BSFRJGRKSA-N |
| XLogP | 7.90 |
| TPSA | 117.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.36 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|