C40H43Cl3NO10P — CID 67538595
2,2,2-trichloroethyl N-[(2S,3R,4R,5S,6R)-5-bis(phenylmethoxy)phosphoryloxy-4-phenylmethoxy-6-(phenylmethoxymethyl)-2-prop-2-enoxyoxan-3-yl]carbamate (PubChem CID 67538595) has the molecular formula C40H43Cl3NO10P and a molecular weight of 835.11 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-[(2S,3R,4R,5S,6R)-5-bis(phenylmethoxy)phosphoryloxy-4-phenylmethoxy-6-(phenylmethoxymethyl)-2-prop-2-enoxyoxan-3-yl]carbamate.
| Compound Name | 2,2,2-trichloroethyl N-[(2S,3R,4R,5S,6R)-5-bis(phenylmethoxy)phosphoryloxy-4-phenylmethoxy-6-(phenylmethoxymethyl)-2-prop-2-enoxyoxan-3-yl]carbamate |
|---|---|
| PubChem CID | 67538595 |
| Molecular Formula | C40H43Cl3NO10P |
| Molecular Weight | 835.11 g/mol |
| Exact Mass | 833.17 |
| IUPAC Name | 2,2,2-trichloroethyl N-[(2S,3R,4R,5S,6R)-5-bis(phenylmethoxy)phosphoryloxy-4-phenylmethoxy-6-(phenylmethoxymethyl)-2-prop-2-enoxyoxan-3-yl]carbamate |
| SMILES | C=CCO[C@H]1O[C@H](COCc2ccccc2)[C@@H](OP(=O)(OCc2ccccc2)OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1NC(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C40H43Cl3NO10P/c1-2-23-48-38-35(44-39(45)50-29-40(41,42)43)37(49-25-31-17-9-4-10-18-31)36(34(53-38)28-47-24-30-15-7-3-8-16-30)54-55(46,51-26-32-19-11-5-12-20-32)52-27-33-21-13-6-14-22-33/h2-22,34-38H,1,23-29H2,(H,44,45)/t34-,35-,36-,37-,38+/m1/s1 |
| InChIKey | BUUHEBUJFYHQNM-WFGAWLSZSA-N |
| XLogP | 9.11 |
| TPSA | 120.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.11 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|