C30H32Cl3NO7 — CID 163299962
2,2,2-trichloroethyl N-[(3R,4R,5S,6R)-2-hydroxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]carbamate (PubChem CID 163299962) has the molecular formula C30H32Cl3NO7 and a molecular weight of 624.95 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-[(3R,4R,5S,6R)-2-hydroxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]carbamate.
| Compound Name | 2,2,2-trichloroethyl N-[(3R,4R,5S,6R)-2-hydroxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]carbamate |
|---|---|
| PubChem CID | 163299962 |
| Molecular Formula | C30H32Cl3NO7 |
| Molecular Weight | 624.95 g/mol |
| Exact Mass | 623.12 |
| IUPAC Name | 2,2,2-trichloroethyl N-[(3R,4R,5S,6R)-2-hydroxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]carbamate |
| SMILES | O=C(N[C@H]1C(O)O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C30H32Cl3NO7/c31-30(32,33)20-40-29(36)34-25-27(39-18-23-14-8-3-9-15-23)26(38-17-22-12-6-2-7-13-22)24(41-28(25)35)19-37-16-21-10-4-1-5-11-21/h1-15,24-28,35H,16-20H2,(H,34,36)/t24-,25-,26-,27-,28?/m1/s1 |
| InChIKey | JPOSOZMAIRKILC-OYDXEKDZSA-N |
| XLogP | 5.56 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.95 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|