C29H30Cl3NO6 — CID 71762848
2,2,2-trichloro-N-[(2S,3R,4R,5R,6R)-2-hydroxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]acetamide (PubChem CID 71762848) has the molecular formula C29H30Cl3NO6 and a molecular weight of 594.92 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[(2S,3R,4R,5R,6R)-2-hydroxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[(2S,3R,4R,5R,6R)-2-hydroxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 71762848 |
| Molecular Formula | C29H30Cl3NO6 |
| Molecular Weight | 594.92 g/mol |
| Exact Mass | 593.11 |
| IUPAC Name | 2,2,2-trichloro-N-[(2S,3R,4R,5R,6R)-2-hydroxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]acetamide |
| SMILES | O=C(N[C@@H]1[C@@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H](COCc2ccccc2)O[C@@H]1O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C29H30Cl3NO6/c30-29(31,32)28(35)33-24-26(38-18-22-14-8-3-9-15-22)25(37-17-21-12-6-2-7-13-21)23(39-27(24)34)19-36-16-20-10-4-1-5-11-20/h1-15,23-27,34H,16-19H2,(H,33,35)/t23-,24-,25+,26-,27+/m1/s1 |
| InChIKey | OIQWGYHAPVOIGA-SEFGFODJSA-N |
| XLogP | 4.95 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.92 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|