C22H26FNO5 — CID 72762659
N-[5-fluoro-2-hydroxy-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl]acetamide (PubChem CID 72762659) has the molecular formula C22H26FNO5 and a molecular weight of 403.45 g/mol. Its IUPAC name is N-[5-fluoro-2-hydroxy-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl]acetamide.
| Compound Name | N-[5-fluoro-2-hydroxy-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 72762659 |
| Molecular Formula | C22H26FNO5 |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | N-[5-fluoro-2-hydroxy-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-3-yl]acetamide |
| SMILES | CC(=O)NC1C(O)OC(COCc2ccccc2)C(F)C1OCc1ccccc1 |
| InChI | InChI=1S/C22H26FNO5/c1-15(25)24-20-21(28-13-17-10-6-3-7-11-17)19(23)18(29-22(20)26)14-27-12-16-8-4-2-5-9-16/h2-11,18-22,26H,12-14H2,1H3,(H,24,25) |
| InChIKey | AIWFLTJGPZWLCF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |