C36H39FNO7P — CID 11422362
[(2R,3R,4R,5S,6R)-3-acetamido-5-fluoro-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-2-yl] dibenzyl phosphite (PubChem CID 11422362) has the molecular formula C36H39FNO7P and a molecular weight of 647.68 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6R)-3-acetamido-5-fluoro-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-2-yl] dibenzyl phosphite.
| Compound Name | [(2R,3R,4R,5S,6R)-3-acetamido-5-fluoro-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-2-yl] dibenzyl phosphite |
|---|---|
| PubChem CID | 11422362 |
| Molecular Formula | C36H39FNO7P |
| Molecular Weight | 647.68 g/mol |
| Exact Mass | 647.24 |
| IUPAC Name | [(2R,3R,4R,5S,6R)-3-acetamido-5-fluoro-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-2-yl] dibenzyl phosphite |
| SMILES | CC(=O)N[C@H]1[C@@H](OP(OCc2ccccc2)OCc2ccccc2)O[C@H](COCc2ccccc2)[C@@H](F)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C36H39FNO7P/c1-27(39)38-34-35(41-23-29-16-8-3-9-17-29)33(37)32(26-40-22-28-14-6-2-7-15-28)44-36(34)45-46(42-24-30-18-10-4-11-19-30)43-25-31-20-12-5-13-21-31/h2-21,32-36H,22-26H2,1H3,(H,38,39)/t32-,33-,34-,35+,36-/m1/s1 |
| InChIKey | LGJLHQLIBNWGLH-ZDWVFLJMSA-N |
| XLogP | 7.03 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.68 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|