C36H37NO7 — CID 91699496
[(2S,3R,4R,5R,6R)-3-acetamido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl] benzoate (PubChem CID 91699496) has the molecular formula C36H37NO7 and a molecular weight of 595.69 g/mol. Its IUPAC name is [(2S,3R,4R,5R,6R)-3-acetamido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl] benzoate.
| Compound Name | [(2S,3R,4R,5R,6R)-3-acetamido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl] benzoate |
|---|---|
| PubChem CID | 91699496 |
| Molecular Formula | C36H37NO7 |
| Molecular Weight | 595.69 g/mol |
| Exact Mass | 595.26 |
| IUPAC Name | [(2S,3R,4R,5R,6R)-3-acetamido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl] benzoate |
| SMILES | CC(=O)N[C@H]1[C@H](OC(=O)c2ccccc2)O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C36H37NO7/c1-26(38)37-32-34(42-24-29-18-10-4-11-19-29)33(41-23-28-16-8-3-9-17-28)31(25-40-22-27-14-6-2-7-15-27)43-36(32)44-35(39)30-20-12-5-13-21-30/h2-21,31-34,36H,22-25H2,1H3,(H,37,38)/t31-,32-,33+,34-,36+/m1/s1 |
| InChIKey | PJBQNRKWCVETMP-QOKMRYHPSA-N |
| XLogP | 5.46 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.69 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |