C31H35NO7 — CID 11214760
methyl (2R,3R,4R,5S,6R)-3-acetamido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane-2-carboxylate (PubChem CID 11214760) has the molecular formula C31H35NO7 and a molecular weight of 533.62 g/mol. Its IUPAC name is methyl (2R,3R,4R,5S,6R)-3-acetamido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane-2-carboxylate.
| Compound Name | methyl (2R,3R,4R,5S,6R)-3-acetamido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane-2-carboxylate |
|---|---|
| PubChem CID | 11214760 |
| Molecular Formula | C31H35NO7 |
| Molecular Weight | 533.62 g/mol |
| Exact Mass | 533.24 |
| IUPAC Name | methyl (2R,3R,4R,5S,6R)-3-acetamido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane-2-carboxylate |
| SMILES | COC(=O)[C@@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1NC(C)=O |
| InChI | InChI=1S/C31H35NO7/c1-22(33)32-27-29(38-20-25-16-10-5-11-17-25)28(37-19-24-14-8-4-9-15-24)26(39-30(27)31(34)35-2)21-36-18-23-12-6-3-7-13-23/h3-17,26-30H,18-21H2,1-2H3,(H,32,33)/t26-,27-,28-,29-,30-/m1/s1 |
| InChIKey | YPYCASIZQNBDDB-XZTOTZIXSA-N |
| XLogP | 3.82 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.62 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |