C32H40NO8P — CID 101430538
N-[(2S,3S,4R,5S,6R)-2-(dimethoxyphosphorylmethyl)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]acetamide (PubChem CID 101430538) has the molecular formula C32H40NO8P and a molecular weight of 597.65 g/mol. Its IUPAC name is N-[(2S,3S,4R,5S,6R)-2-(dimethoxyphosphorylmethyl)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]acetamide.
| Compound Name | N-[(2S,3S,4R,5S,6R)-2-(dimethoxyphosphorylmethyl)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 101430538 |
| Molecular Formula | C32H40NO8P |
| Molecular Weight | 597.65 g/mol |
| Exact Mass | 597.25 |
| IUPAC Name | N-[(2S,3S,4R,5S,6R)-2-(dimethoxyphosphorylmethyl)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]acetamide |
| SMILES | COP(=O)(C[C@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1NC(C)=O)OC |
| InChI | InChI=1S/C32H40NO8P/c1-24(34)33-30-29(23-42(35,36-2)37-3)41-28(22-38-19-25-13-7-4-8-14-25)31(39-20-26-15-9-5-10-16-26)32(30)40-21-27-17-11-6-12-18-27/h4-18,28-32H,19-23H2,1-3H3,(H,33,34)/t28-,29-,30-,31-,32-/m1/s1 |
| InChIKey | ZDOCCYOLJXLBNP-NYDDOVQGSA-N |
| XLogP | 5.13 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.65 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|