C33H42NO9P — CID 102400274
[(2R,3R,4R,5S,6R)-3-acetamido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl] diethyl phosphate (PubChem CID 102400274) has the molecular formula C33H42NO9P and a molecular weight of 627.67 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6R)-3-acetamido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl] diethyl phosphate.
| Compound Name | [(2R,3R,4R,5S,6R)-3-acetamido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl] diethyl phosphate |
|---|---|
| PubChem CID | 102400274 |
| Molecular Formula | C33H42NO9P |
| Molecular Weight | 627.67 g/mol |
| Exact Mass | 627.26 |
| IUPAC Name | [(2R,3R,4R,5S,6R)-3-acetamido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl] diethyl phosphate |
| SMILES | CCOP(=O)(OCC)O[C@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1NC(C)=O |
| InChI | InChI=1S/C33H42NO9P/c1-4-40-44(36,41-5-2)43-33-30(34-25(3)35)32(39-23-28-19-13-8-14-20-28)31(38-22-27-17-11-7-12-18-27)29(42-33)24-37-21-26-15-9-6-10-16-26/h6-20,29-33H,4-5,21-24H2,1-3H3,(H,34,35)/t29-,30-,31-,32-,33-/m1/s1 |
| InChIKey | YGIVZBCXPIKEPM-YKNMHBIISA-N |
| XLogP | 5.80 |
| TPSA | 110.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.67 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|