C26H26BrCl6NO8 — CID 10771492
[(3R,4R,5S,6R)-2-bromo-5-phenylmethoxy-6-(phenylmethoxymethyl)-3-(2,2,2-trichloroethoxycarbonylamino)oxan-4-yl] 2,2,2-trichloroethyl carbonate (PubChem CID 10771492) has the molecular formula C26H26BrCl6NO8 and a molecular weight of 773.11 g/mol. Its IUPAC name is [(3R,4R,5S,6R)-2-bromo-5-phenylmethoxy-6-(phenylmethoxymethyl)-3-(2,2,2-trichloroethoxycarbonylamino)oxan-4-yl] 2,2,2-trichloroethyl carbonate.
| Compound Name | [(3R,4R,5S,6R)-2-bromo-5-phenylmethoxy-6-(phenylmethoxymethyl)-3-(2,2,2-trichloroethoxycarbonylamino)oxan-4-yl] 2,2,2-trichloroethyl carbonate |
|---|---|
| PubChem CID | 10771492 |
| Molecular Formula | C26H26BrCl6NO8 |
| Molecular Weight | 773.11 g/mol |
| Exact Mass | 768.90 |
| IUPAC Name | [(3R,4R,5S,6R)-2-bromo-5-phenylmethoxy-6-(phenylmethoxymethyl)-3-(2,2,2-trichloroethoxycarbonylamino)oxan-4-yl] 2,2,2-trichloroethyl carbonate |
| SMILES | O=C(N[C@H]1C(Br)O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OC(=O)OCC(Cl)(Cl)Cl)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C26H26BrCl6NO8/c27-22-19(34-23(35)39-14-25(28,29)30)21(42-24(36)40-15-26(31,32)33)20(38-12-17-9-5-2-6-10-17)18(41-22)13-37-11-16-7-3-1-4-8-16/h1-10,18-22H,11-15H2,(H,34,35)/t18-,19-,20-,21-,22?/m1/s1 |
| InChIKey | RFZKPBMOBZSXEG-HDKZTWHISA-N |
| XLogP | 7.27 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.11 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|