C33H38Cl3NO7 — CID 102322591
2,2,2-trichloroethyl N-[(2S,3R,4R,5S,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2-propan-2-yloxyoxan-3-yl]carbamate (PubChem CID 102322591) has the molecular formula C33H38Cl3NO7 and a molecular weight of 667.03 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-[(2S,3R,4R,5S,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2-propan-2-yloxyoxan-3-yl]carbamate.
| Compound Name | 2,2,2-trichloroethyl N-[(2S,3R,4R,5S,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2-propan-2-yloxyoxan-3-yl]carbamate |
|---|---|
| PubChem CID | 102322591 |
| Molecular Formula | C33H38Cl3NO7 |
| Molecular Weight | 667.03 g/mol |
| Exact Mass | 665.17 |
| IUPAC Name | 2,2,2-trichloroethyl N-[(2S,3R,4R,5S,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2-propan-2-yloxyoxan-3-yl]carbamate |
| SMILES | CC(C)O[C@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1NC(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C33H38Cl3NO7/c1-23(2)43-31-28(37-32(38)42-22-33(34,35)36)30(41-20-26-16-10-5-11-17-26)29(40-19-25-14-8-4-9-15-25)27(44-31)21-39-18-24-12-6-3-7-13-24/h3-17,23,27-31H,18-22H2,1-2H3,(H,37,38)/t27-,28-,29-,30-,31+/m1/s1 |
| InChIKey | DVJUOPWQPYJEQI-CWMPKMHISA-N |
| XLogP | 6.99 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.03 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|