C34H39Cl3N2O9 — CID 68904139
2-[[(2S,3R,4R,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-3-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]amino]-3-hydroxybutanoic acid (PubChem CID 68904139) has the molecular formula C34H39Cl3N2O9 and a molecular weight of 726.05 g/mol. Its IUPAC name is 2-[[(2S,3R,4R,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-3-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]amino]-3-hydroxybutanoic acid.
| Compound Name | 2-[[(2S,3R,4R,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-3-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 68904139 |
| Molecular Formula | C34H39Cl3N2O9 |
| Molecular Weight | 726.05 g/mol |
| Exact Mass | 724.17 |
| IUPAC Name | 2-[[(2S,3R,4R,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-3-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]amino]-3-hydroxybutanoic acid |
| SMILES | CC(O)C(N[C@H]1O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1NC(=O)OCC(Cl)(Cl)Cl)C(=O)O |
| InChI | InChI=1S/C34H39Cl3N2O9/c1-22(40)27(32(41)42)38-31-28(39-33(43)47-21-34(35,36)37)30(46-19-25-15-9-4-10-16-25)29(45-18-24-13-7-3-8-14-24)26(48-31)20-44-17-23-11-5-2-6-12-23/h2-16,22,26-31,38,40H,17-21H2,1H3,(H,39,43)(H,41,42)/t22?,26-,27?,28-,29+,30-,31+/m1/s1 |
| InChIKey | GFNHOLZIPJYFFC-FUABSQOESA-N |
| XLogP | 4.99 |
| TPSA | 144.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.05 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|