C13H21Cl3N2O9 — CID 150313848
(2S,3R)-2-[[(2S,3R,4R,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]amino]-3-hydroxybutanoic acid (PubChem CID 150313848) has the molecular formula C13H21Cl3N2O9 and a molecular weight of 455.68 g/mol. Its IUPAC name is (2S,3R)-2-[[(2S,3R,4R,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]amino]-3-hydroxybutanoic acid.
| Compound Name | (2S,3R)-2-[[(2S,3R,4R,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 150313848 |
| Molecular Formula | C13H21Cl3N2O9 |
| Molecular Weight | 455.68 g/mol |
| Exact Mass | 454.03 |
| IUPAC Name | (2S,3R)-2-[[(2S,3R,4R,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]amino]-3-hydroxybutanoic acid |
| SMILES | C[C@@H](O)[C@H](N[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1NC(=O)OCC(Cl)(Cl)Cl)C(=O)O |
| InChI | InChI=1S/C13H21Cl3N2O9/c1-4(20)6(11(23)24)17-10-7(9(22)8(21)5(2-19)27-10)18-12(25)26-3-13(14,15)16/h4-10,17,19-22H,2-3H2,1H3,(H,18,25)(H,23,24)/t4-,5-,6+,7-,8+,9-,10+/m1/s1 |
| InChIKey | GMENVKZFCBDVJR-VSVGJDJUSA-N |
| XLogP | -1.69 |
| TPSA | 177.81 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.68 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|