C20H26Cl3NO9 — CID 71155331
benzyl 3-[(2R,4R,5S)-4,5-dihydroxy-6-(hydroxymethyl)-3-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]oxy-2-methylpropanoate (PubChem CID 71155331) has the molecular formula C20H26Cl3NO9 and a molecular weight of 530.79 g/mol. Its IUPAC name is benzyl 3-[(2R,4R,5S)-4,5-dihydroxy-6-(hydroxymethyl)-3-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]oxy-2-methylpropanoate.
| Compound Name | benzyl 3-[(2R,4R,5S)-4,5-dihydroxy-6-(hydroxymethyl)-3-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]oxy-2-methylpropanoate |
|---|---|
| PubChem CID | 71155331 |
| Molecular Formula | C20H26Cl3NO9 |
| Molecular Weight | 530.79 g/mol |
| Exact Mass | 529.07 |
| IUPAC Name | benzyl 3-[(2R,4R,5S)-4,5-dihydroxy-6-(hydroxymethyl)-3-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]oxy-2-methylpropanoate |
| SMILES | CC(CO[C@@H]1OC(CO)[C@@H](O)[C@H](O)C1NC(=O)OCC(Cl)(Cl)Cl)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H26Cl3NO9/c1-11(17(28)30-9-12-5-3-2-4-6-12)8-31-18-14(16(27)15(26)13(7-25)33-18)24-19(29)32-10-20(21,22)23/h2-6,11,13-16,18,25-27H,7-10H2,1H3,(H,24,29)/t11?,13?,14?,15-,16-,18-/m1/s1 |
| InChIKey | OIQHMEUGPVJYGD-FCWRRFNZSA-N |
| XLogP | 1.29 |
| TPSA | 143.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.79 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|