C17H23NO7 — CID 67703192
benzyl N-[(2S,3S,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-prop-2-enoxyoxan-3-yl]carbamate (PubChem CID 67703192) has the molecular formula C17H23NO7 and a molecular weight of 353.37 g/mol. Its IUPAC name is benzyl N-[(2S,3S,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-prop-2-enoxyoxan-3-yl]carbamate.
| Compound Name | benzyl N-[(2S,3S,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-prop-2-enoxyoxan-3-yl]carbamate |
|---|---|
| PubChem CID | 67703192 |
| Molecular Formula | C17H23NO7 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | benzyl N-[(2S,3S,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-prop-2-enoxyoxan-3-yl]carbamate |
| SMILES | C=CCO[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H23NO7/c1-2-8-23-16-13(15(21)14(20)12(9-19)25-16)18-17(22)24-10-11-6-4-3-5-7-11/h2-7,12-16,19-21H,1,8-10H2,(H,18,22)/t12-,13+,14-,15-,16+/m1/s1 |
| InChIKey | FDIWXXHGBTZOAP-JKJDWNRSSA-N |
| XLogP | -0.08 |
| TPSA | 117.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|