C21H29NO8 — CID 11407582
[(2R,3S,4R,5S,6R)-3-hydroxy-2-(hydroxymethyl)-6-pent-4-enoxy-5-(phenylmethoxycarbonylamino)oxan-4-yl] acetate (PubChem CID 11407582) has the molecular formula C21H29NO8 and a molecular weight of 423.46 g/mol. Its IUPAC name is [(2R,3S,4R,5S,6R)-3-hydroxy-2-(hydroxymethyl)-6-pent-4-enoxy-5-(phenylmethoxycarbonylamino)oxan-4-yl] acetate.
| Compound Name | [(2R,3S,4R,5S,6R)-3-hydroxy-2-(hydroxymethyl)-6-pent-4-enoxy-5-(phenylmethoxycarbonylamino)oxan-4-yl] acetate |
|---|---|
| PubChem CID | 11407582 |
| Molecular Formula | C21H29NO8 |
| Molecular Weight | 423.46 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | [(2R,3S,4R,5S,6R)-3-hydroxy-2-(hydroxymethyl)-6-pent-4-enoxy-5-(phenylmethoxycarbonylamino)oxan-4-yl] acetate |
| SMILES | C=CCCCO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](OC(C)=O)[C@@H]1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H29NO8/c1-3-4-8-11-27-20-17(19(29-14(2)24)18(25)16(12-23)30-20)22-21(26)28-13-15-9-6-5-7-10-15/h3,5-7,9-10,16-20,23,25H,1,4,8,11-13H2,2H3,(H,22,26)/t16-,17+,18-,19-,20-/m1/s1 |
| InChIKey | FMAFINDSXKBMRT-USYVTKNRSA-N |
| XLogP | 1.27 |
| TPSA | 123.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.46 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|