C20H27NO7 — CID 56950549
prop-2-enyl N-[(2S,3R,4R,5S,6R)-4-hydroxy-6-(hydroxymethyl)-5-phenylmethoxy-2-prop-2-enoxyoxan-3-yl]carbamate (PubChem CID 56950549) has the molecular formula C20H27NO7 and a molecular weight of 393.44 g/mol. Its IUPAC name is prop-2-enyl N-[(2S,3R,4R,5S,6R)-4-hydroxy-6-(hydroxymethyl)-5-phenylmethoxy-2-prop-2-enoxyoxan-3-yl]carbamate.
| Compound Name | prop-2-enyl N-[(2S,3R,4R,5S,6R)-4-hydroxy-6-(hydroxymethyl)-5-phenylmethoxy-2-prop-2-enoxyoxan-3-yl]carbamate |
|---|---|
| PubChem CID | 56950549 |
| Molecular Formula | C20H27NO7 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | prop-2-enyl N-[(2S,3R,4R,5S,6R)-4-hydroxy-6-(hydroxymethyl)-5-phenylmethoxy-2-prop-2-enoxyoxan-3-yl]carbamate |
| SMILES | C=CCOC(=O)N[C@H]1[C@@H](OCC=C)O[C@H](CO)[C@@H](OCc2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C20H27NO7/c1-3-10-25-19-16(21-20(24)26-11-4-2)17(23)18(15(12-22)28-19)27-13-14-8-6-5-7-9-14/h3-9,15-19,22-23H,1-2,10-13H2,(H,21,24)/t15-,16-,17-,18-,19+/m1/s1 |
| InChIKey | KLCNBRBERMPHRZ-NNIGNNQHSA-N |
| XLogP | 1.13 |
| TPSA | 106.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|