C16H22O6 — CID 11449737
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-phenylmethoxy-4-prop-2-enoxyoxane-3,5-diol (PubChem CID 11449737) has the molecular formula C16H22O6 and a molecular weight of 310.35 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-phenylmethoxy-4-prop-2-enoxyoxane-3,5-diol.
| Compound Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-phenylmethoxy-4-prop-2-enoxyoxane-3,5-diol |
|---|---|
| PubChem CID | 11449737 |
| Molecular Formula | C16H22O6 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-phenylmethoxy-4-prop-2-enoxyoxane-3,5-diol |
| SMILES | C=CCO[C@H]1[C@@H](O)[C@@H](CO)O[C@@H](OCc2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C16H22O6/c1-2-8-20-15-13(18)12(9-17)22-16(14(15)19)21-10-11-6-4-3-5-7-11/h2-7,12-19H,1,8-10H2/t12-,13+,14-,15+,16-/m1/s1 |
| InChIKey | HFXGSLHXSDVAGG-DGADGQDISA-N |
| XLogP | 0.21 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|