C17H24O7 — CID 23255634
(2R,3S,4S,5R,6S)-2-(hydroxymethyl)-4-[(4-methoxyphenyl)methoxy]-6-prop-2-enoxyoxane-3,5-diol (PubChem CID 23255634) has the molecular formula C17H24O7 and a molecular weight of 340.37 g/mol. Its IUPAC name is (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-4-[(4-methoxyphenyl)methoxy]-6-prop-2-enoxyoxane-3,5-diol.
| Compound Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-4-[(4-methoxyphenyl)methoxy]-6-prop-2-enoxyoxane-3,5-diol |
|---|---|
| PubChem CID | 23255634 |
| Molecular Formula | C17H24O7 |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-4-[(4-methoxyphenyl)methoxy]-6-prop-2-enoxyoxane-3,5-diol |
| SMILES | C=CCO[C@H]1O[C@H](CO)[C@H](O)[C@H](OCc2ccc(OC)cc2)[C@H]1O |
| InChI | InChI=1S/C17H24O7/c1-3-8-22-17-15(20)16(14(19)13(9-18)24-17)23-10-11-4-6-12(21-2)7-5-11/h3-7,13-20H,1,8-10H2,2H3/t13-,14+,15-,16+,17+/m1/s1 |
| InChIKey | ZRJLSOLTCSHHCA-ALYAQQCSSA-N |
| XLogP | 0.22 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|