C14H20O7 — CID 91096427
(1S,2R,4S,5S)-6-[(4-methoxyphenyl)methoxy]cyclohexane-1,2,3,4,5-pentol (PubChem CID 91096427) has the molecular formula C14H20O7 and a molecular weight of 300.31 g/mol. Its IUPAC name is (1S,2R,4S,5S)-6-[(4-methoxyphenyl)methoxy]cyclohexane-1,2,3,4,5-pentol.
| Compound Name | (1S,2R,4S,5S)-6-[(4-methoxyphenyl)methoxy]cyclohexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 91096427 |
| Molecular Formula | C14H20O7 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | (1S,2R,4S,5S)-6-[(4-methoxyphenyl)methoxy]cyclohexane-1,2,3,4,5-pentol |
| SMILES | COc1ccc(COC2[C@@H](O)[C@H](O)C(O)[C@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C14H20O7/c1-20-8-4-2-7(3-5-8)6-21-14-12(18)10(16)9(15)11(17)13(14)19/h2-5,9-19H,6H2,1H3/t9?,10-,11+,12-,13-,14?/m0/s1 |
| InChIKey | XKNLTYIJNSUYLO-OBYRSOGISA-N |
| XLogP | -1.60 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |