C28H32O6 — CID 11762365
(3R,4R,5S,6S)-4-[(4-methoxyphenyl)methoxy]-6-methyl-3,5-bis(phenylmethoxy)oxan-2-ol (PubChem CID 11762365) has the molecular formula C28H32O6 and a molecular weight of 464.56 g/mol. Its IUPAC name is (3R,4R,5S,6S)-4-[(4-methoxyphenyl)methoxy]-6-methyl-3,5-bis(phenylmethoxy)oxan-2-ol.
| Compound Name | (3R,4R,5S,6S)-4-[(4-methoxyphenyl)methoxy]-6-methyl-3,5-bis(phenylmethoxy)oxan-2-ol |
|---|---|
| PubChem CID | 11762365 |
| Molecular Formula | C28H32O6 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | (3R,4R,5S,6S)-4-[(4-methoxyphenyl)methoxy]-6-methyl-3,5-bis(phenylmethoxy)oxan-2-ol |
| SMILES | COc1ccc(CO[C@@H]2[C@@H](OCc3ccccc3)[C@H](C)OC(O)[C@@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C28H32O6/c1-20-25(31-17-21-9-5-3-6-10-21)26(32-19-23-13-15-24(30-2)16-14-23)27(28(29)34-20)33-18-22-11-7-4-8-12-22/h3-16,20,25-29H,17-19H2,1-2H3/t20-,25-,26+,27+,28?/m0/s1 |
| InChIKey | SKCOFXBABPWYLV-ZTANDCAXSA-N |
| XLogP | 4.49 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |