C48H48O8 — CID 10897967
(3R,4S,5R,6R)-3,5-bis[(4-methoxyphenyl)methoxy]-4-phenylmethoxy-6-(trityloxymethyl)oxan-2-ol (PubChem CID 10897967) has the molecular formula C48H48O8 and a molecular weight of 752.90 g/mol. Its IUPAC name is (3R,4S,5R,6R)-3,5-bis[(4-methoxyphenyl)methoxy]-4-phenylmethoxy-6-(trityloxymethyl)oxan-2-ol.
| Compound Name | (3R,4S,5R,6R)-3,5-bis[(4-methoxyphenyl)methoxy]-4-phenylmethoxy-6-(trityloxymethyl)oxan-2-ol |
|---|---|
| PubChem CID | 10897967 |
| Molecular Formula | C48H48O8 |
| Molecular Weight | 752.90 g/mol |
| Exact Mass | 752.33 |
| IUPAC Name | (3R,4S,5R,6R)-3,5-bis[(4-methoxyphenyl)methoxy]-4-phenylmethoxy-6-(trityloxymethyl)oxan-2-ol |
| SMILES | COc1ccc(CO[C@H]2[C@H](OCc3ccccc3)[C@@H](OCc3ccc(OC)cc3)C(O)O[C@@H]2COC(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C48H48O8/c1-50-41-27-23-36(24-28-41)32-52-44-43(34-55-48(38-17-9-4-10-18-38,39-19-11-5-12-20-39)40-21-13-6-14-22-40)56-47(49)46(45(44)53-31-35-15-7-3-8-16-35)54-33-37-25-29-42(51-2)30-26-37/h3-30,43-47,49H,31-34H2,1-2H3/t43-,44-,45+,46-,47?/m1/s1 |
| InChIKey | CFBXKJOHDFLDPS-VEWVWOIWSA-N |
| XLogP | 8.49 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.90 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|