C56H58O12 — CID 171123467
[(2R,3S,4S,6R)-3-acetyloxy-6-[[(2R,3R,4S,5R,6S)-6-hydroxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]-2-(trityloxymethyl)oxan-4-yl] acetate (PubChem CID 171123467) has the molecular formula C56H58O12 and a molecular weight of 923.07 g/mol. Its IUPAC name is [(2R,3S,4S,6R)-3-acetyloxy-6-[[(2R,3R,4S,5R,6S)-6-hydroxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]-2-(trityloxymethyl)oxan-4-yl] acetate.
| Compound Name | [(2R,3S,4S,6R)-3-acetyloxy-6-[[(2R,3R,4S,5R,6S)-6-hydroxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]-2-(trityloxymethyl)oxan-4-yl] acetate |
|---|---|
| PubChem CID | 171123467 |
| Molecular Formula | C56H58O12 |
| Molecular Weight | 923.07 g/mol |
| Exact Mass | 922.39 |
| IUPAC Name | [(2R,3S,4S,6R)-3-acetyloxy-6-[[(2R,3R,4S,5R,6S)-6-hydroxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]-2-(trityloxymethyl)oxan-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H](OC(C)=O)C[C@H](OC[C@H]2O[C@H](O)[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)O[C@@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C56H58O12/c1-39(57)65-47-33-50(67-49(51(47)66-40(2)58)38-64-56(44-27-15-6-16-28-44,45-29-17-7-18-30-45)46-31-19-8-20-32-46)60-37-48-52(61-34-41-21-9-3-10-22-41)53(62-35-42-23-11-4-12-24-42)54(55(59)68-48)63-36-43-25-13-5-14-26-43/h3-32,47-55,59H,33-38H2,1-2H3/t47-,48+,49+,50+,51-,52+,53-,54+,55-/m0/s1 |
| InChIKey | CJOQBGBZRXMCBT-RORZSARASA-N |
| XLogP | 8.46 |
| TPSA | 137.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 923.07 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|