C29H30O7 — CID 171125559
[(3S)-3-acetyloxy-6-hydroxy-2-(trityloxymethyl)oxan-4-yl] acetate (PubChem CID 171125559) has the molecular formula C29H30O7 and a molecular weight of 490.55 g/mol. Its IUPAC name is [(3S)-3-acetyloxy-6-hydroxy-2-(trityloxymethyl)oxan-4-yl] acetate.
| Compound Name | [(3S)-3-acetyloxy-6-hydroxy-2-(trityloxymethyl)oxan-4-yl] acetate |
|---|---|
| PubChem CID | 171125559 |
| Molecular Formula | C29H30O7 |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | [(3S)-3-acetyloxy-6-hydroxy-2-(trityloxymethyl)oxan-4-yl] acetate |
| SMILES | CC(=O)OC1CC(O)OC(COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@H]1OC(C)=O |
| InChI | InChI=1S/C29H30O7/c1-20(30)34-25-18-27(32)36-26(28(25)35-21(2)31)19-33-29(22-12-6-3-7-13-22,23-14-8-4-9-15-23)24-16-10-5-11-17-24/h3-17,25-28,32H,18-19H2,1-2H3/t25?,26?,27?,28-/m0/s1 |
| InChIKey | YCTODQIPQYCGML-OYGGZRDRSA-N |
| XLogP | 3.97 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|