C29H30O6 — CID 102013121
[(3aR,5R,6S,6aR)-2,2-dimethyl-5-(trityloxymethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] acetate (PubChem CID 102013121) has the molecular formula C29H30O6 and a molecular weight of 474.55 g/mol. Its IUPAC name is [(3aR,5R,6S,6aR)-2,2-dimethyl-5-(trityloxymethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] acetate.
| Compound Name | [(3aR,5R,6S,6aR)-2,2-dimethyl-5-(trityloxymethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] acetate |
|---|---|
| PubChem CID | 102013121 |
| Molecular Formula | C29H30O6 |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | [(3aR,5R,6S,6aR)-2,2-dimethyl-5-(trityloxymethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H30O6/c1-20(30)32-25-24(33-27-26(25)34-28(2,3)35-27)19-31-29(21-13-7-4-8-14-21,22-15-9-5-10-16-22)23-17-11-6-12-18-23/h4-18,24-27H,19H2,1-3H3/t24-,25+,26-,27-/m1/s1 |
| InChIKey | SFMDDQHFMBLZQC-HVWQDESWSA-N |
| XLogP | 4.80 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|