C30H32O5 — CID 11016185
(3aR,5R,6R,6aR)-2,2-dimethyl-6-prop-2-enoxy-5-(trityloxymethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 11016185) has the molecular formula C30H32O5 and a molecular weight of 472.58 g/mol. Its IUPAC name is (3aR,5R,6R,6aR)-2,2-dimethyl-6-prop-2-enoxy-5-(trityloxymethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (3aR,5R,6R,6aR)-2,2-dimethyl-6-prop-2-enoxy-5-(trityloxymethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 11016185 |
| Molecular Formula | C30H32O5 |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | (3aR,5R,6R,6aR)-2,2-dimethyl-6-prop-2-enoxy-5-(trityloxymethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | C=CCO[C@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H32O5/c1-4-20-31-26-25(33-28-27(26)34-29(2,3)35-28)21-32-30(22-14-8-5-9-15-22,23-16-10-6-11-17-23)24-18-12-7-13-19-24/h4-19,25-28H,1,20-21H2,2-3H3/t25-,26-,27-,28-/m1/s1 |
| InChIKey | PSHCQDTVJYXMNI-BIYDSLDMSA-N |
| XLogP | 5.44 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|