C41H44O5 — CID 11072183
(2S,3S,4R,5R,6R)-4-phenylmethoxy-3,5-bis(prop-2-enoxy)-2-prop-2-enyl-6-(trityloxymethyl)oxane (PubChem CID 11072183) has the molecular formula C41H44O5 and a molecular weight of 616.80 g/mol. Its IUPAC name is (2S,3S,4R,5R,6R)-4-phenylmethoxy-3,5-bis(prop-2-enoxy)-2-prop-2-enyl-6-(trityloxymethyl)oxane.
| Compound Name | (2S,3S,4R,5R,6R)-4-phenylmethoxy-3,5-bis(prop-2-enoxy)-2-prop-2-enyl-6-(trityloxymethyl)oxane |
|---|---|
| PubChem CID | 11072183 |
| Molecular Formula | C41H44O5 |
| Molecular Weight | 616.80 g/mol |
| Exact Mass | 616.32 |
| IUPAC Name | (2S,3S,4R,5R,6R)-4-phenylmethoxy-3,5-bis(prop-2-enoxy)-2-prop-2-enyl-6-(trityloxymethyl)oxane |
| SMILES | C=CCO[C@@H]1[C@@H](OCc2ccccc2)[C@H](OCC=C)[C@@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)O[C@H]1CC=C |
| InChI | InChI=1S/C41H44O5/c1-4-19-36-38(42-28-5-2)40(44-30-32-20-11-7-12-21-32)39(43-29-6-3)37(46-36)31-45-41(33-22-13-8-14-23-33,34-24-15-9-16-25-34)35-26-17-10-18-27-35/h4-18,20-27,36-40H,1-3,19,28-31H2/t36-,37+,38-,39+,40+/m0/s1 |
| InChIKey | JMAQRFOQMUMSME-WBHVZLLVSA-N |
| XLogP | 8.07 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.80 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|