C36H48O5Si — CID 72723984
tert-butyl-dimethyl-[[(2R,3R,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-prop-2-enyloxan-2-yl]methoxy]silane (PubChem CID 72723984) has the molecular formula C36H48O5Si and a molecular weight of 588.86 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(2R,3R,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-prop-2-enyloxan-2-yl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(2R,3R,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-prop-2-enyloxan-2-yl]methoxy]silane |
|---|---|
| PubChem CID | 72723984 |
| Molecular Formula | C36H48O5Si |
| Molecular Weight | 588.86 g/mol |
| Exact Mass | 588.33 |
| IUPAC Name | tert-butyl-dimethyl-[[(2R,3R,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-prop-2-enyloxan-2-yl]methoxy]silane |
| SMILES | C=CC[C@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C36H48O5Si/c1-7-17-31-33(37-24-28-18-11-8-12-19-28)35(39-26-30-22-15-10-16-23-30)34(38-25-29-20-13-9-14-21-29)32(41-31)27-40-42(5,6)36(2,3)4/h7-16,18-23,31-35H,1,17,24-27H2,2-6H3/t31-,32-,33+,34-,35-/m1/s1 |
| InChIKey | DJOHWIHUFGTXKV-CKQPALCZSA-N |
| XLogP | 8.11 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.86 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|