C36H49N3O5Si — CID 22498114
[6-(3-azidopropyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 22498114) has the molecular formula C36H49N3O5Si and a molecular weight of 631.89 g/mol. Its IUPAC name is [6-(3-azidopropyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [6-(3-azidopropyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 22498114 |
| Molecular Formula | C36H49N3O5Si |
| Molecular Weight | 631.89 g/mol |
| Exact Mass | 631.34 |
| IUPAC Name | [6-(3-azidopropyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCC1OC(CCCN=[N+]=[N-])C(OCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C36H49N3O5Si/c1-36(2,3)45(4,5)43-27-32-34(41-25-29-18-11-7-12-19-29)35(42-26-30-20-13-8-14-21-30)33(31(44-32)22-15-23-38-39-37)40-24-28-16-9-6-10-17-28/h6-14,16-21,31-35H,15,22-27H2,1-5H3 |
| InChIKey | VRDFQZMCYZGVEN-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 94.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.89 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|