C45H58O7Si — CID 11650644
(3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[(2S,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]butanal (PubChem CID 11650644) has the molecular formula C45H58O7Si and a molecular weight of 739.04 g/mol. Its IUPAC name is (3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[(2S,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]butanal.
| Compound Name | (3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[(2S,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]butanal |
|---|---|
| PubChem CID | 11650644 |
| Molecular Formula | C45H58O7Si |
| Molecular Weight | 739.04 g/mol |
| Exact Mass | 738.40 |
| IUPAC Name | (3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[(2S,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]butanal |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H](CC=O)C[C@@H]1O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C45H58O7Si/c1-45(2,3)53(4,5)51-33-39(26-27-46)28-40-42(48-30-36-20-12-7-13-21-36)44(50-32-38-24-16-9-17-25-38)43(49-31-37-22-14-8-15-23-37)41(52-40)34-47-29-35-18-10-6-11-19-35/h6-25,27,39-44H,26,28-34H2,1-5H3/t39-,40-,41+,42-,43-,44+/m0/s1 |
| InChIKey | JVVJDHNYRCCFPY-ZYEKJNOESA-N |
| XLogP | 9.34 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.04 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|