C44H58O7Si — CID 178166627
tert-butyl-dimethyl-[4-[(2R,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxybutoxy]silane (PubChem CID 178166627) has the molecular formula C44H58O7Si and a molecular weight of 727.03 g/mol. Its IUPAC name is tert-butyl-dimethyl-[4-[(2R,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxybutoxy]silane.
| Compound Name | tert-butyl-dimethyl-[4-[(2R,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxybutoxy]silane |
|---|---|
| PubChem CID | 178166627 |
| Molecular Formula | C44H58O7Si |
| Molecular Weight | 727.03 g/mol |
| Exact Mass | 726.40 |
| IUPAC Name | tert-butyl-dimethyl-[4-[(2R,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxybutoxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCO[C@@H]1O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C44H58O7Si/c1-44(2,3)52(4,5)50-29-19-18-28-46-43-42(49-33-38-26-16-9-17-27-38)41(48-32-37-24-14-8-15-25-37)40(47-31-36-22-12-7-13-23-36)39(51-43)34-45-30-35-20-10-6-11-21-35/h6-17,20-27,39-43H,18-19,28-34H2,1-5H3/t39-,40+,41+,42-,43-/m1/s1 |
| InChIKey | UZXKXSHBPDXXFU-XJIHQHRMSA-N |
| XLogP | 9.50 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.03 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|