C55H56O6P+ — CID 101007759
triphenyl-[3-[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxypropyl]phosphanium (PubChem CID 101007759) has the molecular formula C55H56O6P+ and a molecular weight of 844.02 g/mol. Its IUPAC name is triphenyl-[3-[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxypropyl]phosphanium.
| Compound Name | triphenyl-[3-[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxypropyl]phosphanium |
|---|---|
| PubChem CID | 101007759 |
| Molecular Formula | C55H56O6P+ |
| Molecular Weight | 844.02 g/mol |
| Exact Mass | 843.38 |
| IUPAC Name | triphenyl-[3-[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxypropyl]phosphanium |
| SMILES | c1ccc(COC[C@H]2O[C@@H](OCCC[P+](c3ccccc3)(c3ccccc3)c3ccccc3)[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C55H56O6P/c1-8-23-44(24-9-1)39-56-43-51-52(58-40-45-25-10-2-11-26-45)53(59-41-46-27-12-3-13-28-46)54(60-42-47-29-14-4-15-30-47)55(61-51)57-37-22-38-62(48-31-16-5-17-32-48,49-33-18-6-19-34-49)50-35-20-7-21-36-50/h1-21,23-36,51-55H,22,37-43H2/q+1/t51-,52-,53+,54-,55-/m1/s1 |
| InChIKey | OAAPQCAQCJDOGD-CGUSVCNXSA-N |
| XLogP | 10.09 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.02 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|