C54H56O10 — CID 58850430
dibenzyl 2-[3-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxypropyl]propanedioate (PubChem CID 58850430) has the molecular formula C54H56O10 and a molecular weight of 865.03 g/mol. Its IUPAC name is dibenzyl 2-[3-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxypropyl]propanedioate.
| Compound Name | dibenzyl 2-[3-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxypropyl]propanedioate |
|---|---|
| PubChem CID | 58850430 |
| Molecular Formula | C54H56O10 |
| Molecular Weight | 865.03 g/mol |
| Exact Mass | 864.39 |
| IUPAC Name | dibenzyl 2-[3-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxypropyl]propanedioate |
| SMILES | O=C(OCc1ccccc1)C(CCCOC1OC(COCc2ccccc2)C(OCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C54H56O10/c55-52(62-38-45-28-15-5-16-29-45)47(53(56)63-39-46-30-17-6-18-31-46)32-19-33-58-54-51(61-37-44-26-13-4-14-27-44)50(60-36-43-24-11-3-12-25-43)49(59-35-42-22-9-2-10-23-42)48(64-54)40-57-34-41-20-7-1-8-21-41/h1-18,20-31,47-51,54H,19,32-40H2 |
| InChIKey | SJRRJZKNRIIBRX-UHFFFAOYSA-N |
| XLogP | 9.58 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 865.03 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|