C61H64O11 — CID 54589858
(3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-[[(2S,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxymethyl]oxan-2-ol (PubChem CID 54589858) has the molecular formula C61H64O11 and a molecular weight of 973.17 g/mol. Its IUPAC name is (3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-[[(2S,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxymethyl]oxan-2-ol.
| Compound Name | (3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-[[(2S,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxymethyl]oxan-2-ol |
|---|---|
| PubChem CID | 54589858 |
| Molecular Formula | C61H64O11 |
| Molecular Weight | 973.17 g/mol |
| Exact Mass | 972.44 |
| IUPAC Name | (3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-[[(2S,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxymethyl]oxan-2-ol |
| SMILES | OC1O[C@H](CO[C@H]2O[C@H](COCc3ccccc3)[C@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C61H64O11/c62-60-58(68-41-50-32-18-6-19-33-50)56(66-39-48-28-14-4-15-29-48)55(65-38-47-26-12-3-13-27-47)53(71-60)44-70-61-59(69-42-51-34-20-7-21-35-51)57(67-40-49-30-16-5-17-31-49)54(64-37-46-24-10-2-11-25-46)52(72-61)43-63-36-45-22-8-1-9-23-45/h1-35,52-62H,36-44H2/t52-,53-,54+,55-,56+,57+,58-,59-,60?,61+/m1/s1 |
| InChIKey | OSTZQPZGIHZMMS-YJBVGCHTSA-N |
| XLogP | 10.17 |
| TPSA | 112.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 973.17 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |