C40H46O11 — CID 69266562
(3R,4S,5S,6R)-6-(hydroxymethyl)-3-[(2S,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyoxane-2,4,5-triol (PubChem CID 69266562) has the molecular formula C40H46O11 and a molecular weight of 702.80 g/mol. Its IUPAC name is (3R,4S,5S,6R)-6-(hydroxymethyl)-3-[(2S,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyoxane-2,4,5-triol.
| Compound Name | (3R,4S,5S,6R)-6-(hydroxymethyl)-3-[(2S,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyoxane-2,4,5-triol |
|---|---|
| PubChem CID | 69266562 |
| Molecular Formula | C40H46O11 |
| Molecular Weight | 702.80 g/mol |
| Exact Mass | 702.30 |
| IUPAC Name | (3R,4S,5S,6R)-6-(hydroxymethyl)-3-[(2S,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyoxane-2,4,5-triol |
| SMILES | OC[C@H]1OC(O)[C@H](O[C@@H]2O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C40H46O11/c41-21-31-33(42)34(43)36(39(44)49-31)51-40-38(48-25-30-19-11-4-12-20-30)37(47-24-29-17-9-3-10-18-29)35(46-23-28-15-7-2-8-16-28)32(50-40)26-45-22-27-13-5-1-6-14-27/h1-20,31-44H,21-26H2/t31-,32-,33-,34+,35-,36-,37+,38-,39?,40+/m1/s1 |
| InChIKey | FPHALNFZQGENKV-NSRDCNPRSA-N |
| XLogP | 3.50 |
| TPSA | 145.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.80 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |