C45H44IO4P — CID 11320340
[(2S,3S,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]methyl-triphenylphosphanium iodide (PubChem CID 11320340) has the molecular formula C45H44IO4P and a molecular weight of 806.72 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]methyl-triphenylphosphanium iodide.
| Compound Name | [(2S,3S,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]methyl-triphenylphosphanium iodide |
|---|---|
| PubChem CID | 11320340 |
| Molecular Formula | C45H44IO4P |
| Molecular Weight | 806.72 g/mol |
| Exact Mass | 806.20 |
| IUPAC Name | [(2S,3S,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]methyl-triphenylphosphanium iodide |
| SMILES | [I-].c1ccc(COC[C@H]2O[C@H](C[P+](c3ccccc3)(c3ccccc3)c3ccccc3)[C@@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C45H44O4P.HI/c1-7-19-36(20-8-1)31-46-34-42-44(47-32-37-21-9-2-10-22-37)45(48-33-38-23-11-3-12-24-38)43(49-42)35-50(39-25-13-4-14-26-39,40-27-15-5-16-28-40)41-29-17-6-18-30-41;/h1-30,42-45H,31-35H2;1H/q+1;/p-1/t42-,43-,44-,45-;/m1./s1 |
| InChIKey | QWIHYASSWZVHPE-XJSRFIJTSA-M |
| XLogP | 5.14 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.72 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|