C46H46IO5P — CID 11170375
[(2S,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl-triphenylphosphanium iodide (PubChem CID 11170375) has the molecular formula C46H46IO5P and a molecular weight of 836.75 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl-triphenylphosphanium iodide.
| Compound Name | [(2S,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl-triphenylphosphanium iodide |
|---|---|
| PubChem CID | 11170375 |
| Molecular Formula | C46H46IO5P |
| Molecular Weight | 836.75 g/mol |
| Exact Mass | 836.21 |
| IUPAC Name | [(2S,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl-triphenylphosphanium iodide |
| SMILES | CO[C@H]1O[C@H](C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1.[I-] |
| InChI | InChI=1S/C46H46O5P.HI/c1-47-46-45(50-34-38-24-12-4-13-25-38)44(49-33-37-22-10-3-11-23-37)43(48-32-36-20-8-2-9-21-36)42(51-46)35-52(39-26-14-5-15-27-39,40-28-16-6-17-29-40)41-30-18-7-19-31-41;/h2-31,42-46H,32-35H2,1H3;1H/q+1;/p-1/t42-,43+,44+,45-,46+;/m1./s1 |
| InChIKey | PNENXHIZTYTYKK-XFDJKAIASA-M |
| XLogP | 5.11 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.75 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|