C41H56O9 — CID 25085916
(3R,4S,5S)-2-[[(2S,3S,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]oxymethyl]-3,4-dimethoxy-5-octoxyoxolane (PubChem CID 25085916) has the molecular formula C41H56O9 and a molecular weight of 692.89 g/mol. Its IUPAC name is (3R,4S,5S)-2-[[(2S,3S,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]oxymethyl]-3,4-dimethoxy-5-octoxyoxolane.
| Compound Name | (3R,4S,5S)-2-[[(2S,3S,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]oxymethyl]-3,4-dimethoxy-5-octoxyoxolane |
|---|---|
| PubChem CID | 25085916 |
| Molecular Formula | C41H56O9 |
| Molecular Weight | 692.89 g/mol |
| Exact Mass | 692.39 |
| IUPAC Name | (3R,4S,5S)-2-[[(2S,3S,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]oxymethyl]-3,4-dimethoxy-5-octoxyoxolane |
| SMILES | CCCCCCCCO[C@H]1OC(CO[C@H]2O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)[C@@H](OC)[C@@H]1OC |
| InChI | InChI=1S/C41H56O9/c1-4-5-6-7-8-18-25-45-40-38(43-3)36(42-2)35(50-40)30-48-41-39(47-28-33-23-16-11-17-24-33)37(46-27-32-21-14-10-15-22-32)34(49-41)29-44-26-31-19-12-9-13-20-31/h9-17,19-24,34-41H,4-8,18,25-30H2,1-3H3/t34-,35?,36-,37-,38+,39+,40+,41+/m1/s1 |
| InChIKey | CQLLZHUKTPZMCW-TXNHIJGUSA-N |
| XLogP | 7.25 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.89 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|