C34H42O6 — CID 101138475
[(2R,3R,4S,5R)-5-octoxy-3,4-bis(phenylmethoxy)oxolan-2-yl]methyl benzoate (PubChem CID 101138475) has the molecular formula C34H42O6 and a molecular weight of 546.70 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-5-octoxy-3,4-bis(phenylmethoxy)oxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4S,5R)-5-octoxy-3,4-bis(phenylmethoxy)oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 101138475 |
| Molecular Formula | C34H42O6 |
| Molecular Weight | 546.70 g/mol |
| Exact Mass | 546.30 |
| IUPAC Name | [(2R,3R,4S,5R)-5-octoxy-3,4-bis(phenylmethoxy)oxolan-2-yl]methyl benzoate |
| SMILES | CCCCCCCCO[C@@H]1O[C@H](COC(=O)c2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C34H42O6/c1-2-3-4-5-6-16-23-36-34-32(38-25-28-19-12-8-13-20-28)31(37-24-27-17-10-7-11-18-27)30(40-34)26-39-33(35)29-21-14-9-15-22-29/h7-15,17-22,30-32,34H,2-6,16,23-26H2,1H3/t30-,31-,32+,34-/m1/s1 |
| InChIKey | KUDQENXAZFHJAJ-ZNGFCOMISA-N |
| XLogP | 7.12 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.70 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|